EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18ClNO |
| Net Charge | 0 |
| Average Mass | 311.812 |
| Monoisotopic Mass | 311.10769 |
| SMILES | O=C1C=C(NCc2ccccc2)C[C@@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H18ClNO/c20-17-8-6-15(7-9-17)16-10-18(12-19(22)11-16)21-13-14-4-2-1-3-5-14/h1-9,12,16,21H,10-11,13H2/t16-/m1/s1 |
| InChIKey | VCMYAMGOMKBIBC-MRXNPFEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(benzylamino)-5-(4-chlorophenyl)cyclohex-2-en-1-one (CHEBI:167843) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| 3-(benzylamino)-5-(4-chlorophenyl)cyclohex-2-en-1-one |
| Manual Xrefs | Databases |
|---|---|
| 2084615 | ChemSpider |