EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2S |
| Net Charge | 0 |
| Average Mass | 197.259 |
| Monoisotopic Mass | 197.05105 |
| SMILES | CCCSc1ncccc1C(=O)O |
| InChI | InChI=1S/C9H11NO2S/c1-2-6-13-8-7(9(11)12)4-3-5-10-8/h3-5H,2,6H2,1H3,(H,11,12) |
| InChIKey | CSMDLVRDBYKTAH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(propylthio)nicotinic acid (CHEBI:167828) is a aromatic carboxylic acid (CHEBI:33859) |
| 2-(propylthio)nicotinic acid (CHEBI:167828) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2-propylsulanylpyridine-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2054922 | ChemSpider |