EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H26O3 |
| Net Charge | 0 |
| Average Mass | 230.348 |
| Monoisotopic Mass | 230.18819 |
| SMILES | CCCOCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H26O3/c1-2-11-16-12-9-7-5-3-4-6-8-10-13(14)15/h2-12H2,1H3,(H,14,15) |
| InChIKey | HSRAJJQTYQHRSA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-propoxydecanoic acid (CHEBI:167816) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 10-propoxydecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 108899 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:119290-00-5 | ChemIDplus |