EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | COc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C8H8O4/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,9H,1H3,(H,10,11) |
| InChIKey | MRIXVKKOHPQOFK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calophyllum polyanthum (ncbitaxon:1679397) | seed (BTO:0001226) | PubMed (15387670) | |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) | |
| Periploca sepium (ncbitaxon:190712) | bark (BTO:0001301) | PubMed (17879730) | Isolated from root bark. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-4-methoxybenzoic acid (CHEBI:167809) has role plant metabolite (CHEBI:76924) |
| 2-hydroxy-4-methoxybenzoic acid (CHEBI:167809) is a methoxybenzoic acid (CHEBI:25238) |
| 2-hydroxy-4-methoxybenzoic acid (CHEBI:167809) is a monohydroxybenzoic acid (CHEBI:25389) |
| 2-hydroxy-4-methoxybenzoic acid (CHEBI:167809) is conjugate acid of 2-hydroxy-4-methoxybenzoate (CHEBI:188933) |
| Incoming Relation(s) |
| 2-hydroxy-4-methoxybenzoate (CHEBI:188933) is conjugate base of 2-hydroxy-4-methoxybenzoic acid (CHEBI:167809) |
| IUPAC Name |
|---|
| 2-hydroxy-4-methoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-p-anisic acid | ChEBI |
| 4-methoxy-2-hydroxybenzoic acid | ChEBI |
| 4-methoxysalicylic acid | ChEBI |
| p-methoxysalicylic acid | ChEBI |
| Citations |
|---|