EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7N |
| Net Charge | 0 |
| Average Mass | 117.151 |
| Monoisotopic Mass | 117.05785 |
| SMILES | C#Cc1ccc(N)cc1 |
| InChI | InChI=1S/C8H7N/c1-2-7-3-5-8(9)6-4-7/h1,3-6H,9H2 |
| InChIKey | JXYITCJMBRETQX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-ethynylaniline (CHEBI:167803) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 4-ethynylaniline |
| Manual Xrefs | Databases |
|---|---|
| 2989097 | ChemSpider |