EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19F3N2O4S |
| Net Charge | 0 |
| Average Mass | 404.410 |
| Monoisotopic Mass | 404.10176 |
| SMILES | C[C@H](Cc1ccc(OCC(=O)O)cc1)NC[C@H](O)c1csc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H19F3N2O4S/c1-10(6-11-2-4-12(5-3-11)26-8-15(24)25)21-7-14(23)13-9-27-16(22-13)17(18,19)20/h2-5,9-10,14,21,23H,6-8H2,1H3,(H,24,25)/t10-,14+/m1/s1 |
| InChIKey | YVIXXPCJZAUQHJ-YGRLFVJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cp-114271 (CHEBI:167796) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-[4-[(2R)-2-[[(2S)-2-hydroxy-2-[2-(triluoromethyl)-1,3-thiazol-4-yl]ethyl]amino]propyl]phenoxy]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 8128655 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:162326-86-5 | ChemIDplus |