EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N3O3 |
| Net Charge | 0 |
| Average Mass | 297.314 |
| Monoisotopic Mass | 297.11134 |
| SMILES | CCOC(=O)C(C#N)=CNc1cc(OC)cc2cccnc12 |
| InChI | InChI=1S/C16H15N3O3/c1-3-22-16(20)12(9-17)10-19-14-8-13(21-2)7-11-5-4-6-18-15(11)14/h4-8,10,19H,3H2,1-2H3 |
| InChIKey | SPIFGNJOLVTQLH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl 2-cyano-3-[(6-methoxy-8-quinolyl)amino]acrylate (CHEBI:167788) is a aminoquinoline (CHEBI:36709) |
| IUPAC Name |
|---|
| ethyl 2-cyano-3-[(6-methoxyquinolin-8-yl)amino]prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 2984540 | ChemSpider |