EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:167785 - Ethyl malonate
| Formula | C7H12O4 |
| Net Charge | 0 |
| Average Mass | 160.169 |
| Monoisotopic Mass | 160.07356 |
| SMILES | CCOC(=O)CC(=O)OCC |
| InChI | InChI=1S/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3 |
| InChIKey | IYXGSMUGOJNHAZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl malonate (CHEBI:167785) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| diethyl propanedioate |
| Manual Xrefs | Databases |
|---|---|
| 13863636 | ChemSpider |
| HMDB0029573 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:105-53-3 | ChemIDplus |