EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N3O |
| Net Charge | 0 |
| Average Mass | 189.218 |
| Monoisotopic Mass | 189.09021 |
| SMILES | Cc1cc(NCc2cccnc2)no1 |
| InChI | InChI=1S/C10H11N3O/c1-8-5-10(13-14-8)12-7-9-3-2-4-11-6-9/h2-6H,7H2,1H3,(H,12,13) |
| InChIKey | YCTIWOKDBYCFJC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyl-n-(pyridin-3-ylmethyl)isoxazol-3-amine (CHEBI:167778) is a secondary amine (CHEBI:32863) |
| IUPAC Name |
|---|
| 5-methyl-N-(pyridin-3-ylmethyl)-1,2-oxazol-3-amine |
| Manual Xrefs | Databases |
|---|---|
| 2008752 | ChemSpider |