EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24ClN3O5 |
| Net Charge | 0 |
| Average Mass | 457.914 |
| Monoisotopic Mass | 457.14045 |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H](O)C(=O)N1C[C@@H](O)[C@@H](O)C1)c1cc2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C23H24ClN3O5/c24-15-6-7-16-14(9-15)10-18(25-16)22(31)26-17(8-13-4-2-1-3-5-13)21(30)23(32)27-11-19(28)20(29)12-27/h1-7,9-10,17,19-21,25,28-30H,8,11-12H2,(H,26,31)/t17-,19-,20+,21+/m0/s1 |
| InChIKey | GVDRRZOORHCTAN-MJUUVYJYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ingliforib (CHEBI:167777) is a indolecarboxamide (CHEBI:46921) |
| Ingliforib (CHEBI:167777) is a indolyl carboxylic acid (CHEBI:46867) |
| Ingliforib (CHEBI:167777) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 5-chloro-N-[(2S,3R)-4-[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-hydroxy-4-oxo-1-phenylbutan-2-yl]-1H-indole-2-carboxamide |
| INN | Source |
|---|---|
| ingliforib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP-368,296 | ChEMBL |
| CP-368296 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:186392-65-4 | ChemIDplus |