EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2O2 |
| Net Charge | 0 |
| Average Mass | 154.169 |
| Monoisotopic Mass | 154.07423 |
| SMILES | COC(=O)/C(C#N)=C/N(C)C |
| InChI | InChI=1S/C7H10N2O2/c1-9(2)5-6(4-8)7(10)11-3/h5H,1-3H3/b6-5+ |
| InChIKey | HWBIEDPFULRCDP-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 2-cyano-3-(dimethylamino)acrylate (CHEBI:167772) is a enamine (CHEBI:47989) |
| Methyl 2-cyano-3-(dimethylamino)acrylate (CHEBI:167772) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| methyl (E)-2-cyano-3-(dimethylamino)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 2013944 | ChemSpider |