EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O2 |
| Net Charge | 0 |
| Average Mass | 138.166 |
| Monoisotopic Mass | 138.06808 |
| SMILES | CCC(=O)c1ccc(C)o1 |
| InChI | InChI=1S/C8H10O2/c1-3-7(9)8-5-4-6(2)10-8/h4-5H,3H2,1-2H3 |
| InChIKey | BXLPZYAVKVFXEO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-5-propionylfuran (CHEBI:167764) has role flavouring agent (CHEBI:35617) |
| 2-methyl-5-propionylfuran (CHEBI:167764) has role human metabolite (CHEBI:77746) |
| 2-methyl-5-propionylfuran (CHEBI:167764) has role plant metabolite (CHEBI:76924) |
| 2-methyl-5-propionylfuran (CHEBI:167764) is a aromatic ketone (CHEBI:76224) |
| 2-methyl-5-propionylfuran (CHEBI:167764) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 1-(5-methylfuran-2-yl)propan-1-one |
| Synonyms | Source |
|---|---|
| 1-(5-methyl-2-furanyl)-1-propanone | NIST Chemistry WebBook |
| 1-(5-methyl-2-furyl)-1-propanone | NIST Chemistry WebBook |
| 1-(5-methyl-2-furyl)propan-1-one | ChemIDplus |
| 2-methyl-5-propionyl-furan | ChEBI |
| 5-methyl-2-propionylfuran | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 74682 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:113098 | Reaxys |
| CAS:10599-69-6 | NIST Chemistry WebBook |
| CAS:10599-69-6 | ChemIDplus |
| Citations |
|---|