EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N3O2 |
| Net Charge | 0 |
| Average Mass | 271.320 |
| Monoisotopic Mass | 271.13208 |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1cc2ccoc2cn1 |
| InChI | InChI=1S/C15H17N3O2/c19-15(12-7-11-3-6-20-14(11)8-16-12)17-13-9-18-4-1-10(13)2-5-18/h3,6-8,10,13H,1-2,4-5,9H2,(H,17,19)/t13-/m0/s1 |
| InChIKey | IPKZCLGGYKRDES-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pha-543613 (CHEBI:167763) is a aromatic carboxylic acid (CHEBI:33859) |
| Pha-543613 (CHEBI:167763) is a organic molecular entity (CHEBI:50860) |
| Pha-543613 (CHEBI:167763) is a organothiophosphorus compound (CHEBI:25716) |
| Pha-543613 (CHEBI:167763) is a phosphoramide (CHEBI:17102) |
| Pha-543613 (CHEBI:167763) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| IUPAC Name |
|---|
| N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]uro[2,3-c]pyridine-5-carboxamide |
| Synonyms | Source |
|---|---|
| J3.179.420J | ChEMBL |
| Pha-00543613 | ChEMBL |
| Pha-543613 | ChEMBL |
| PHA-543,613 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 8105752 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:478149-53-0 | ChemIDplus |
| Citations |
|---|