EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO4 |
| Net Charge | 0 |
| Average Mass | 237.255 |
| Monoisotopic Mass | 237.10011 |
| SMILES | COc1ccc(C(CC(N)=O)CC(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO4/c1-17-10-4-2-8(3-5-10)9(6-11(13)14)7-12(15)16/h2-5,9H,6-7H2,1H3,(H2,13,14)(H,15,16) |
| InChIKey | TWOBZOCYRADJOC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-amino-3-(4-methoxyphenyl)-5-oxopentanoic acid (CHEBI:167758) is a benzenes (CHEBI:22712) |
| 5-amino-3-(4-methoxyphenyl)-5-oxopentanoic acid (CHEBI:167758) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 5-amino-3-(4-methoxyphenyl)-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2082317 | ChemSpider |