EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O4 |
| Net Charge | 0 |
| Average Mass | 202.250 |
| Monoisotopic Mass | 202.12051 |
| SMILES | CC(C)(C)C(CCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H18O4/c1-10(2,3)7(6-9(13)14)4-5-8(11)12/h7H,4-6H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | LHSCNQRBIIDZCB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-tert-butyladipic acid (CHEBI:167756) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 3-tert-butylhexanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 89392 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:10347-88-3 | ChemIDplus |