EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO4 |
| Net Charge | 0 |
| Average Mass | 209.201 |
| Monoisotopic Mass | 209.06881 |
| SMILES | O=C(O)C1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C10H11NO4/c12-9-4-7(10(13)14)5-11(9)6-8-2-1-3-15-8/h1-3,7H,4-6H2,(H,13,14) |
| InChIKey | NFWHHUCJMAPGHE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2-furylmethyl)-5-oxopyrrolidine-3-carboxylic acid (CHEBI:167748) is a oxoproline (CHEBI:25801) |
| IUPAC Name |
|---|
| 1-(uran-2-ylmethyl)-5-oxopyrrolidine-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2057565 | ChemSpider |