EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O7 |
| Net Charge | 0 |
| Average Mass | 366.370 |
| Monoisotopic Mass | 366.14270 |
| SMILES | CCOC(=O)c1ccc(N2CCOCC2)c(NC(=O)COCC(=O)O)c1 |
| InChI | InChI=1S/C17H22N2O7/c1-2-26-17(23)12-3-4-14(19-5-7-24-8-6-19)13(9-12)18-15(20)10-25-11-16(21)22/h3-4,9H,2,5-8,10-11H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | CWOKIISJEHAUAY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | MetaboLights (MTBLS2542) | ||
| blood serum (BTO:0000133 blood serum) | MetaboLights (MTBLS2542 MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{2-[5-(ethoxycarbonyl)-2-morpholinoanilino]-2-oxoethoxy}acetic acid (CHEBI:167734) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2-[2-(5-ethoxycarbonyl-2-morpholin-4-ylanilino)-2-oxoethoxy]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 2089419 | ChemSpider |