EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2S |
| Net Charge | 0 |
| Average Mass | 161.226 |
| Monoisotopic Mass | 161.05105 |
| SMILES | NC1(C(=O)O)CCSCC1 |
| InChI | InChI=1S/C6H11NO2S/c7-6(5(8)9)1-3-10-4-2-6/h1-4,7H2,(H,8,9) |
| InChIKey | WIPRZHGCPZSPLJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminotetrahydro-2H-thiopyran-4-carboxylic acid (CHEBI:167728) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| 4-aminothiane-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 298070 | ChemSpider |