EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H39N7O2 |
| Net Charge | 0 |
| Average Mass | 541.700 |
| Monoisotopic Mass | 541.31652 |
| SMILES | CCCc1cc(C)nc(=O)c1CNC(=O)c1cc(-c2ccnc(N3CCN(C)CC3)c2)cc2c1cnn2C(C)C |
| InChI | InChI=1S/C31H39N7O2/c1-6-7-23-14-21(4)35-31(40)26(23)18-33-30(39)25-15-24(16-28-27(25)19-34-38(28)20(2)3)22-8-9-32-29(17-22)37-12-10-36(5)11-13-37/h8-9,14-17,19-20H,6-7,10-13,18H2,1-5H3,(H,33,39)(H,35,40) |
| InChIKey | ULNXAWLQFZMIHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.1.1.43 (enhancer of zeste homolog 2) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of Enhancer of zeste homolog 2 (EZH2), a histone-lysine N-methyltransferase (EC 2.1.1.43). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK343 (CHEBI:167693) has role antineoplastic agent (CHEBI:35610) |
| GSK343 (CHEBI:167693) has role apoptosis inducer (CHEBI:68495) |
| GSK343 (CHEBI:167693) has role EC 2.1.1.43 (enhancer of zeste homolog 2) inhibitor (CHEBI:167694) |
| GSK343 (CHEBI:167693) is a N-alkylpiperazine (CHEBI:46845) |
| GSK343 (CHEBI:167693) is a N-arylpiperazine (CHEBI:46848) |
| GSK343 (CHEBI:167693) is a aminopyridine (CHEBI:38207) |
| GSK343 (CHEBI:167693) is a indazoles (CHEBI:38769) |
| GSK343 (CHEBI:167693) is a pyridone (CHEBI:38183) |
| GSK343 (CHEBI:167693) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 1-isopropyl-N-[(6-methyl-2-oxo-4-propyl-1,2-dihydropyridin-3-yl)methyl]-6-[2-(4-methylpiperazin-1-yl)pyridin-4-yl]-1H-indazole-4-carboxamide |
| Synonyms | Source |
|---|---|
| GSK-343 | ChEBI |
| GSK 343 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CA2798622 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1346704-33-3 | ChEBI |
| Citations |
|---|