EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O5 |
| Net Charge | 0 |
| Average Mass | 428.569 |
| Monoisotopic Mass | 428.25627 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]3(C[C@]4(C)C(C)=C(C(=O)OC)C(=O)C(C)=C4O3)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C26H36O5/c1-14-9-10-17-23(4,5)18(27)11-12-25(17,7)26(14)13-24(6)16(3)19(22(29)30-8)20(28)15(2)21(24)31-26/h14,17H,9-13H2,1-8H3/t14-,17-,24+,25-,26-/m0/s1 |
| InChIKey | WZDKBDIIRCLIKU-MNKLQMRISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chermesin D methyl ester (CHEBI:167691) is a cyclic ketone (CHEBI:3992) |
| chermesin D methyl ester (CHEBI:167691) is a meroterpenoid (CHEBI:64419) |
| chermesin D methyl ester (CHEBI:167691) is a methyl ester (CHEBI:25248) |
| chermesin D methyl ester (CHEBI:167691) is a organic heterotetracyclic compound (CHEBI:38163) |
| UniProt Name | Source |
|---|---|
| chermesin D methyl ester | UniProt |
| Citations |
|---|