EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O8 |
| Net Charge | 0 |
| Average Mass | 464.555 |
| Monoisotopic Mass | 464.24102 |
| SMILES | [H][C@@]12C(=O)O[C@@](C)(O[C@@]34OC[C@]56CCC(=O)OC(C)(C)[C@]5([H])CC[C@H](C)[C@]6(C[C@]3(C)[C@H]1C)O4)[C@H]2O |
| InChI | InChI=1S/C25H36O8/c1-13-7-8-15-20(3,4)30-16(26)9-10-23(15)12-29-25-21(5,11-24(13,23)33-25)14(2)17-18(27)22(6,32-25)31-19(17)28/h13-15,17-18,27H,7-12H2,1-6H3/t13-,14-,15-,17+,18-,21+,22-,23+,24-,25-/m0/s1 |
| InChIKey | WIDQCQPZDGKHGX-DHFAPYKTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumigatonoid C (CHEBI:167689) is a meroterpenoid (CHEBI:64419) |
| fumigatonoid C (CHEBI:167689) is a organic heteropolycyclic compound (CHEBI:38166) |
| fumigatonoid C (CHEBI:167689) is a ortho ester (CHEBI:71989) |
| UniProt Name | Source |
|---|---|
| fumigatonoid C | UniProt |
| Citations |
|---|