EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O6 |
| Net Charge | 0 |
| Average Mass | 444.568 |
| Monoisotopic Mass | 444.25119 |
| SMILES | [H][C@@]12CC[C@H](C)[C@@]3(C[C@]4(C)C(C)=C(C(=O)OC)C(=O)C(C)=C4O3)[C@@]1(C)CCC(=O)OC2(C)C |
| InChI | InChI=1S/C26H36O6/c1-14-9-10-17-23(4,5)31-18(27)11-12-25(17,7)26(14)13-24(6)16(3)19(22(29)30-8)20(28)15(2)21(24)32-26/h14,17H,9-13H2,1-8H3/t14-,17-,24+,25-,26-/m0/s1 |
| InChIKey | YQWBCSIREWBSHS-MNKLQMRISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus novofumigatus IBT 16806 (ncbitaxon:1392255) | - | PubMed (29968715) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asnovolin K (CHEBI:167685) has role Aspergillus metabolite (CHEBI:76956) |
| asnovolin K (CHEBI:167685) is a cyclic ketone (CHEBI:3992) |
| asnovolin K (CHEBI:167685) is a meroterpenoid (CHEBI:64419) |
| asnovolin K (CHEBI:167685) is a methyl ester (CHEBI:25248) |
| asnovolin K (CHEBI:167685) is a organic heterotetracyclic compound (CHEBI:38163) |
| asnovolin K (CHEBI:167685) is a ε-lactone (CHEBI:50239) |
| IUPAC Name |
|---|
| methyl (2S,3aR,5a'S,7'S,9a'R)-1',1',3a,4,5a',7,7'-heptamethyl-3',6-dioxo-3',3a,4',5',5a',6,7',8',9',9a'-decahydro-1'H,3H-spiro[[1]benzofuran-2,6'-[2]benzoxepine]-5-carboxylate |
| UniProt Name | Source |
|---|---|
| asnovolin K | UniProt |
| Citations |
|---|