EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O5 |
| Net Charge | 0 |
| Average Mass | 430.585 |
| Monoisotopic Mass | 430.27192 |
| SMILES | [H][C@@]1(C(=O)OC)C(=O)C(C)=C2O[C@@]3(C[C@]2(C)[C@H]1C)[C@@H](C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]31C |
| InChI | InChI=1S/C26H38O5/c1-14-9-10-17-23(4,5)18(27)11-12-25(17,7)26(14)13-24(6)16(3)19(22(29)30-8)20(28)15(2)21(24)31-26/h14,16-17,19H,9-13H2,1-8H3/t14-,16-,17-,19-,24+,25-,26-/m0/s1 |
| InChIKey | XKJJMXDQESYKLS-IGZQQFENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus novofumigatus IBT 16806 (ncbitaxon:1392255) | - | PubMed (29968715) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asnovolin J (CHEBI:167683) has role Aspergillus metabolite (CHEBI:76956) |
| asnovolin J (CHEBI:167683) is a cyclic ketone (CHEBI:3992) |
| asnovolin J (CHEBI:167683) is a meroterpenoid (CHEBI:64419) |
| asnovolin J (CHEBI:167683) is a methyl ester (CHEBI:25248) |
| asnovolin J (CHEBI:167683) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| methyl (1'S,2'S,3aR,4S,4a'R,5S,8a'S)-2',3a,4,5',5',7,8a'-heptamethyl-6,6'-dioxo-3',3a,4,4',4a',5,5',6,6',7',8',8a'-dodecahydro-2'H,3H-spiro[[1]benzofuran-2,1'-naphthalene]-5-carboxylate |
| UniProt Name | Source |
|---|---|
| asnovolin J | UniProt |
| Citations |
|---|