EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H30N2O12S |
| Net Charge | 0 |
| Average Mass | 486.496 |
| Monoisotopic Mass | 486.15195 |
| SMILES | CC(=O)N[C@@H](CS)C(=O)N[C@H]1[C@@H](O[C@@H]2[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H30N2O12S/c1-4(21)18-5(3-32)16(29)19-7-9(23)8(22)6(2-20)30-17(7)31-15-13(27)11(25)10(24)12(26)14(15)28/h5-15,17,20,22-28,32H,2-3H2,1H3,(H,18,21)(H,19,29)/t5-,6+,7+,8+,9+,10-,11-,12+,13+,14+,15-,17+/m0/s1 |
| InChIKey | MQBCDKMPXVYCGO-FQBKTPCVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. |
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mycothiol (CHEBI:16768) has functional parent myo-inositol (CHEBI:17268) |
| mycothiol (CHEBI:16768) has role bacterial metabolite (CHEBI:76969) |
| mycothiol (CHEBI:16768) has role cofactor (CHEBI:23357) |
| mycothiol (CHEBI:16768) has role reducing agent (CHEBI:63247) |
| mycothiol (CHEBI:16768) is a 2-deoxy-α-D-glucoside (CHEBI:37449) |
| mycothiol (CHEBI:16768) is a mycothiols (CHEBI:25441) |
| mycothiol (CHEBI:16768) is a thiol (CHEBI:29256) |
| Incoming Relation(s) |
| S-(hydroxymethyl)mycothiol (CHEBI:61586) has functional parent mycothiol (CHEBI:16768) |
| S-formylmycothiol (CHEBI:15735) has functional parent mycothiol (CHEBI:16768) |
| S-nitrosomycothiol (CHEBI:59637) has functional parent mycothiol (CHEBI:16768) |
| mycothiol S-conjugate (CHEBI:59633) has functional parent mycothiol (CHEBI:16768) |
| mycothione (CHEBI:16086) has functional parent mycothiol (CHEBI:16768) |
| IUPAC Name |
|---|
| 1-O-{2-[(N-acetyl-L-cysteinyl)amino]-2-deoxy-α-D-glucopyranosyl}-1D-myo-inositol |
| Synonyms | Source |
|---|---|
| Mycothiol | KEGG COMPOUND |
| 1-D-myo-inositol-2-(N-acetyl-L-cysteinyl)amino-2-deoxy-alpha-D-glucopyranoside | ChEBI |
| 1-O-[2-(N-acetyl-L-cysteinamido)-2-deoxy-α-D-glucopyranosyl]-D-myo-inositol | IUBMB |
| 1D-1-O-[2-(N-acetyl-L-cysteinamido)-2-deoxy-α-D-glucopyranosyl]-myo-inositol | IUPAC |
| 1-O-(2-[N-acetyl-L-cysteinyl]amido-2-deoxy-α-D-glucopyranosyl)-D-myo-inositol | IUBMB |
| (1S,2R,3R,4S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl 2-[(N-acetyl-L-cysteinyl)amino]-2-deoxy-α-D-glucopyranoside | IUPAC |
| UniProt Name | Source |
|---|---|
| mycothiol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9308053 | Beilstein |
| Reaxys:9308053 | Reaxys |
| CAS:192126-76-4 | ChemIDplus |
| Citations |
|---|