EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16NO |
| Net Charge | +1 |
| Average Mass | 142.222 |
| Monoisotopic Mass | 142.12264 |
| SMILES | [H][C@@]12CCCC[NH+]1CC[C@H]2O |
| InChI | InChI=1S/C8H15NO/c10-8-4-6-9-5-2-1-3-7(8)9/h7-8,10H,1-6H2/p+1/t7-,8+/m0/s1 |
| InChIKey | IATZHJGSCGLJSL-JGVFFNPUSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,8aS)-octahydroindolizin-1-ol(1+) (CHEBI:167675) is a indolizidine alkaloid (CHEBI:38511) |
| UniProt Name | Source |
|---|---|
| (1R,8aS)-octahydroindolizin-1-ol | UniProt |
| Citations |
|---|