EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25Cl2FN4O2 |
| Net Charge | 0 |
| Average Mass | 491.394 |
| Monoisotopic Mass | 490.13386 |
| SMILES | [H][C@@]1(COc2cc3ncnc(Nc4ccc(Cl)c(Cl)c4F)c3cc2OC)C[C@]2([H])CN(C)C[C@]2([H])C1 |
| InChI | InChI=1S/C24H25Cl2FN4O2/c1-31-9-14-5-13(6-15(14)10-31)11-33-21-8-19-16(7-20(21)32-2)24(29-12-28-19)30-18-4-3-17(25)22(26)23(18)27/h3-4,7-8,12-15H,5-6,9-11H2,1-2H3,(H,28,29,30)/t13-,14-,15+ |
| InChIKey | HVXKQKFEHMGHSL-QKDCVEJESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). epidermal growth factor receptor antagonist An antagonist at the epidermal growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tesevatinib (CHEBI:167674) has role antineoplastic agent (CHEBI:35610) |
| tesevatinib (CHEBI:167674) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| tesevatinib (CHEBI:167674) has role epidermal growth factor receptor antagonist (CHEBI:74440) |
| tesevatinib (CHEBI:167674) is a aromatic ether (CHEBI:35618) |
| tesevatinib (CHEBI:167674) is a dichlorobenzene (CHEBI:23697) |
| tesevatinib (CHEBI:167674) is a diether (CHEBI:46786) |
| tesevatinib (CHEBI:167674) is a monofluorobenzenes (CHEBI:83575) |
| tesevatinib (CHEBI:167674) is a quinazolines (CHEBI:38530) |
| tesevatinib (CHEBI:167674) is a secondary amino compound (CHEBI:50995) |
| tesevatinib (CHEBI:167674) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(3,4-dichloro-2-fluorophenyl)-6-methoxy-7-{[(3aR,5r,6aS)-2-methyloctahydrocyclopenta[c]pyrrol-5-yl]methoxy}quinazolin-4-amine |
| INNs | Source |
|---|---|
| tesevatinib | WHO MedNet |
| tesevatinib | WHO MedNet |
| tésévatinib | WHO MedNet |
| tesevatinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 7-{[(3aR,5R,6aS)-2-methyl-octahydrocyclopenta[c]pyrrol-5-yl]methoxy}-N-(3,4-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine | IUPAC |
| EXEL 7647 | ChemIDplus |
| EXEL-7647 | ChemIDplus |
| EXEL7647 | ChEBI |
| KD 019 | ChemIDplus |
| KD-019 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 32699556 | ChemSpider |
| D11772 | KEGG DRUG |
| DB11973 | DrugBank |
| Tesevatinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:781613-23-8 | ChemIDplus |
| CAS:781613-23-8 | KEGG DRUG |
| Citations |
|---|