EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H18F4N4O3S |
| Net Charge | 0 |
| Average Mass | 554.525 |
| Monoisotopic Mass | 554.10357 |
| SMILES | N#Cc1c(Oc2ccc(F)c(NC(=O)Cc3cccc(C(F)(F)F)c3)c2)ccc2nc(NC(=O)C3CC3)sc12 |
| InChI | InChI=1S/C27H18F4N4O3S/c28-19-7-6-17(12-21(19)33-23(36)11-14-2-1-3-16(10-14)27(29,30)31)38-22-9-8-20-24(18(22)13-32)39-26(34-20)35-25(37)15-4-5-15/h1-3,6-10,12,15H,4-5,11H2,(H,33,36)(H,34,35,37) |
| InChIKey | OJFKUJDRGJSAQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) necroptosis inhibitor Any substance that inhibits the process of necroptosis (programmed form of necrosis) in organisms. EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TAK-632 (CHEBI:167673) has role antineoplastic agent (CHEBI:35610) |
| TAK-632 (CHEBI:167673) has role apoptosis inducer (CHEBI:68495) |
| TAK-632 (CHEBI:167673) has role B-Raf inhibitor (CHEBI:75047) |
| TAK-632 (CHEBI:167673) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| TAK-632 (CHEBI:167673) has role necroptosis inhibitor (CHEBI:167704) |
| TAK-632 (CHEBI:167673) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| TAK-632 (CHEBI:167673) is a aromatic ether (CHEBI:35618) |
| TAK-632 (CHEBI:167673) is a benzothiazoles (CHEBI:37947) |
| TAK-632 (CHEBI:167673) is a cyclopropylcarboxamide (CHEBI:51456) |
| TAK-632 (CHEBI:167673) is a monofluorobenzenes (CHEBI:83575) |
| TAK-632 (CHEBI:167673) is a nitrile (CHEBI:18379) |
| TAK-632 (CHEBI:167673) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[7-cyano-6-(4-fluoro-3-{2-[3-(trifluoromethyl)phenyl]acetamido}phenoxy)-1,3-benzothiazol-2-yl]cyclopropanecarboxamide |
| Synonyms | Source |
|---|---|
| TAK 632 | ChEBI |
| TAK632 | ChEBI |
| N-(7-cyano-6-(4-fluoro-3-(2-(3-(trifluoromethyl)phenyl)acetamido)phenoxy)benzo[d]thiazol-2-yl)cyclopropanecarboxamide | ChEBI |
| N-[5-[[7-cyano-2-[(cyclopropylcarbonyl)amino]-6-benzothiazolyl]oxy]-2-fluorophenyl]-3-(trifluoromethyl)-benzeneacetamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1SU | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1228591-30-7 | ChEBI |
| Citations |
|---|