EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12Cl2F3N7O2S |
| Net Charge | 0 |
| Average Mass | 506.297 |
| Monoisotopic Mass | 505.01023 |
| SMILES | C[C@@H](NC(=O)c1ncnc(N)c1Cl)c1ncc(C(=O)Nc2cc(C(F)(F)F)c(Cl)cn2)s1 |
| InChI | InChI=1S/C17H12Cl2F3N7O2S/c1-6(28-15(31)12-11(19)13(23)27-5-26-12)16-25-4-9(32-16)14(30)29-10-2-7(17(20,21)22)8(18)3-24-10/h2-6H,1H3,(H,28,31)(H2,23,26,27)(H,24,29,30)/t6-/m1/s1 |
| InChIKey | VWMJHAFYPMOMGF-ZCFIWIBFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TAK-580 (CHEBI:167672) has role antineoplastic agent (CHEBI:35610) |
| TAK-580 (CHEBI:167672) has role apoptosis inducer (CHEBI:68495) |
| TAK-580 (CHEBI:167672) has role B-Raf inhibitor (CHEBI:75047) |
| TAK-580 (CHEBI:167672) is a 1,3-thiazolecarboxamide (CHEBI:48890) |
| TAK-580 (CHEBI:167672) is a aminopyrimidine (CHEBI:38338) |
| TAK-580 (CHEBI:167672) is a chloropyridine (CHEBI:39173) |
| TAK-580 (CHEBI:167672) is a organofluorine compound (CHEBI:37143) |
| TAK-580 (CHEBI:167672) is a pyrimidinecarboxamide (CHEBI:48438) |
| TAK-580 (CHEBI:167672) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 6-amino-5-chloro-N-[(1R)-1-(5-{[5-chloro-4-(trifluoromethyl)pyridin-2-yl]carbamoyl}-1,3-thiazol-2-yl)ethyl]pyrimidine-4-carboxamide |
| Synonyms | Source |
|---|---|
| BIIB-024 | ChemIDplus |
| DAY101 | SUBMITTER |
| 2-[(1R)-1-[(6-amino-5-chloropyrimidine-4-carbonyl)amino]ethyl]-N-[5-chloro-4-(trifluoromethyl)pyridin-2-yl]-1,3-thiazole-5-carboxamide | IUPAC |
| MLN 2480 | ChemIDplus |
| BIIB 024 | ChemIDplus |
| AMG 2112819 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| DB15266 | DrugBank |
| 28637796 | ChemSpider |
| QOP | PDBeChem |
| LSM-45644 | LINCS |
| US20090036419 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1096708-71-2 | ChemIDplus |
| Citations |
|---|