EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35NO2 |
| Net Charge | 0 |
| Average Mass | 321.505 |
| Monoisotopic Mass | 321.26678 |
| SMILES | CCCCCCCCc1ccc(CC[C@@](N)(CO)COC)cc1 |
| InChI | InChI=1S/C20H35NO2/c1-3-4-5-6-7-8-9-18-10-12-19(13-11-18)14-15-20(21,16-22)17-23-2/h10-13,22H,3-9,14-17,21H2,1-2H3/t20-/m1/s1 |
| InChIKey | YEYZALQTJCVXIJ-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.1.91 (sphingosine kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of sphinganine kinase (EC 2.7.1.91). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-amino-2-(methoxymethyl)-4-(4-octylphenyl)butan-1-ol (CHEBI:167668) has role EC 2.7.1.91 (sphingosine kinase) inhibitor (CHEBI:78760) |
| (2R)-2-amino-2-(methoxymethyl)-4-(4-octylphenyl)butan-1-ol (CHEBI:167668) is a 2-amino-2-(methoxymethyl)-4-(4-octylphenyl)butan-1-ol (CHEBI:167708) |
| IUPAC Name |
|---|
| (2R)-2-amino-2-(methoxymethyl)-4-(4-octylphenyl)butan-1-ol |
| Synonyms | Source |
|---|---|
| (R)-FTY720 methyl ether | SUBMITTER |
| (R)-FTY720-OMe | ChEBI |
| (R)-2-amino-2-(methoxymethyl)-4-(4-octylphenyl)butan-1-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 28667627 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1382486-90-9 | ChEBI |
| Citations |
|---|