EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H25N3O4S2 |
| Net Charge | 0 |
| Average Mass | 519.648 |
| Monoisotopic Mass | 519.12865 |
| SMILES | [H]C(=Nc1ccccc1NS(=O)(=O)c1ccc(C)cc1)c1ccccc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H25N3O4S2/c1-20-11-15-23(16-12-20)35(31,32)29-25-8-4-3-7-22(25)19-28-26-9-5-6-10-27(26)30-36(33,34)24-17-13-21(2)14-18-24/h3-19,29-30H,1-2H3 |
| InChIKey | FLDBNMYJUMAXDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.91 (sphingosine kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of sphinganine kinase (EC 2.7.1.91). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MP-A08 (CHEBI:167665) has role angiogenesis inhibitor (CHEBI:48422) |
| MP-A08 (CHEBI:167665) has role antineoplastic agent (CHEBI:35610) |
| MP-A08 (CHEBI:167665) has role apoptosis inducer (CHEBI:68495) |
| MP-A08 (CHEBI:167665) has role EC 2.7.1.91 (sphingosine kinase) inhibitor (CHEBI:78760) |
| MP-A08 (CHEBI:167665) is a aldimine (CHEBI:33271) |
| MP-A08 (CHEBI:167665) is a sulfonamide (CHEBI:35358) |
| MP-A08 (CHEBI:167665) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 4-methyl-N-{2-[(2-{[(4-methylphenyl)sulfonyl]amino}benzylidene)amino]phenyl}benzenesulfonamide |
| Synonyms | Source |
|---|---|
| 4-methyl-N-[2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]iminomethyl]phenyl]benzenesulfonamide | ChEBI |
| MP A08 | ChEBI |
| MPA08 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 24832025 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:219832-49-2 | ChEBI |
| Citations |
|---|