EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H25N3O4S2 |
| Net Charge | 0 |
| Average Mass | 519.648 |
| Monoisotopic Mass | 519.12865 |
| SMILES | [H]C(=Nc1ccccc1NS(=O)(=O)c1ccc(C)cc1)c1ccccc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H25N3O4S2/c1-20-11-15-23(16-12-20)35(31,32)29-25-8-4-3-7-22(25)19-28-26-9-5-6-10-27(26)30-36(33,34)24-17-13-21(2)14-18-24/h3-19,29-30H,1-2H3 |
| InChIKey | FLDBNMYJUMAXDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.1.91 (sphingosine kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of sphinganine kinase (EC 2.7.1.91). |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MP-A08 (CHEBI:167665) has role angiogenesis inhibitor (CHEBI:48422) |
| MP-A08 (CHEBI:167665) has role antineoplastic agent (CHEBI:35610) |
| MP-A08 (CHEBI:167665) has role apoptosis inducer (CHEBI:68495) |
| MP-A08 (CHEBI:167665) has role EC 2.7.1.91 (sphingosine kinase) inhibitor (CHEBI:78760) |
| MP-A08 (CHEBI:167665) is a aldimine (CHEBI:33271) |
| MP-A08 (CHEBI:167665) is a sulfonamide (CHEBI:35358) |
| MP-A08 (CHEBI:167665) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 4-methyl-N-{2-[(2-{[(4-methylphenyl)sulfonyl]amino}benzylidene)amino]phenyl}benzenesulfonamide |
| Synonyms | Source |
|---|---|
| 4-methyl-N-[2-[[2-[(4-methylphenyl)sulfonylamino]phenyl]iminomethyl]phenyl]benzenesulfonamide | ChEBI |
| MP A08 | ChEBI |
| MPA08 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 24832025 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:219832-49-2 | ChEBI |
| Citations |
|---|