EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H41N9O3S |
| Net Charge | 0 |
| Average Mass | 691.862 |
| Monoisotopic Mass | 691.30531 |
| SMILES | CS[C@@]1(C(=O)Nc2ccc3nnc(-c4ccc(OC(C)C)nc4)c3c2)CCN(CC(=O)N2CC=C(c3ccc(-c4ncn(C)n4)cc3)CC2)C1 |
| InChI | InChI=1S/C37H41N9O3S/c1-24(2)49-32-12-9-28(20-38-32)34-30-19-29(10-11-31(30)41-42-34)40-36(48)37(50-4)15-18-45(22-37)21-33(47)46-16-13-26(14-17-46)25-5-7-27(8-6-25)35-39-23-44(3)43-35/h5-13,19-20,23-24H,14-18,21-22H2,1-4H3,(H,40,48)(H,41,42)/t37-/m0/s1 |
| InChIKey | KPQQGHGDBBJGFA-QNGWXLTQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MK-8353 (CHEBI:167664) has role antineoplastic agent (CHEBI:35610) |
| MK-8353 (CHEBI:167664) has role apoptosis inducer (CHEBI:68495) |
| MK-8353 (CHEBI:167664) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| MK-8353 (CHEBI:167664) is a N-alkylpyrrolidine (CHEBI:46775) |
| MK-8353 (CHEBI:167664) is a aromatic ether (CHEBI:35618) |
| MK-8353 (CHEBI:167664) is a dihydropyridine (CHEBI:50075) |
| MK-8353 (CHEBI:167664) is a indazoles (CHEBI:38769) |
| MK-8353 (CHEBI:167664) is a methyl sulfide (CHEBI:86315) |
| MK-8353 (CHEBI:167664) is a pyridines (CHEBI:26421) |
| MK-8353 (CHEBI:167664) is a pyrrolidinecarboxamide (CHEBI:46770) |
| MK-8353 (CHEBI:167664) is a secondary carboxamide (CHEBI:140325) |
| MK-8353 (CHEBI:167664) is a tertiary carboxamide (CHEBI:140326) |
| MK-8353 (CHEBI:167664) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| (3S)-3-(methylsulfanyl)-1-(2-{4-[4-(1-methyl-1H-1,2,4-triazol-3-yl)phenyl]-3,6-dihydropyridin-1(2H)-yl}-2-oxoethyl)-N-{3-[6-(propan-2-yloxy)pyridin-3-yl]-1H-indazol-5-yl}pyrrolidine-3-carboxamide |
| Synonyms | Source |
|---|---|
| MK 8353 | ChEBI |
| MK8353 | ChEBI |
| SCH-900353 | ChEBI |
| SCH900353 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| G67 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1184173-73-6 | ChEBI |
| Citations |
|---|