EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H57N15O4 |
| Net Charge | 0 |
| Average Mass | 763.953 |
| Monoisotopic Mass | 763.47180 |
| SMILES | CC(C)(C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)Cc1ccc(CNC(=N)N)cc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)NCc1ccc(C(=N)N)cc1 |
| InChI | InChI=1S/C36H57N15O4/c1-36(2,3)28(32(55)50-25(6-4-16-45-33(39)40)30(53)47-19-23-12-14-24(15-13-23)29(37)38)51-31(54)26(7-5-17-46-34(41)42)49-27(52)18-21-8-10-22(11-9-21)20-48-35(43)44/h8-15,25-26,28H,4-7,16-20H2,1-3H3,(H3,37,38)(H,47,53)(H,49,52)(H,50,55)(H,51,54)(H4,39,40,45)(H4,41,42,46)(H4,43,44,48)/t25-,26-,28+/m0/s1 |
| InChIKey | HXVPWVPTVOOCMV-UNCTUWKVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.4.21.75 (furin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of furin (EC 3.4.21.75). peptidomimetic A small protein-like chain designed to mimic a peptide. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MI-1148 (CHEBI:167663) has functional parent L-arginine (CHEBI:16467) |
| MI-1148 (CHEBI:167663) has role antibacterial agent (CHEBI:33282) |
| MI-1148 (CHEBI:167663) has role antiviral agent (CHEBI:22587) |
| MI-1148 (CHEBI:167663) has role EC 3.4.21.75 (furin) inhibitor (CHEBI:156297) |
| MI-1148 (CHEBI:167663) has role peptidomimetic (CHEBI:63175) |
| MI-1148 (CHEBI:167663) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| N2-{[4-(carbamimidamidomethyl)phenyl]acetyl}-L-arginyl-3-methyl-L-valyl-N-(4-carbamimidoylbenzyl)-L-argininamide |
| Synonyms | Source |
|---|---|
| (2S)-5-carbamimidamido-2-{[(2S)-2-{[(2S)-5-carbamimidamido-2-{2-[4-(carbamimidamidomethyl)phenyl]acetamido}pentanoyl]amino}-3,3-dimethylbutanoyl]amino}-N-(4-carbamimidoylbenzyl)pentanamide | IUPAC |
| 4-guanidinomethyl-Phac-Arg-Tle-Arg-4-amba | ChEBI |
| 4-(guanidinomethyl)phenylacetyl-Arg-Tle-Arg-4-amidinobenzylamide | ChEBI |
| 4-guanidinomethyl-phenylacteyl-Arg-Tle-Arg-4-amidinobenzylamide | ChEBI |
| N2-{[4-(carbamimidamidomethyl)phenyl]acetyl}-L-arginyl-3-methyl-L-valyl-N-[(4-carbamimidoylphenyl)methyl]-L-argininamide | IUPAC |
| MI 1148 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 35033268 | ChemSpider |
| Citations |
|---|