EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29FN6O |
| Net Charge | 0 |
| Average Mass | 424.524 |
| Monoisotopic Mass | 424.23869 |
| SMILES | CNc1ncc2cc(-c3cc(NC(=O)NCCC(C)(C)C)c(F)cc3C)c(C)nc2n1 |
| InChI | InChI=1S/C23H29FN6O/c1-13-9-18(24)19(29-22(31)26-8-7-23(3,4)5)11-16(13)17-10-15-12-27-21(25-6)30-20(15)28-14(17)2/h9-12H,7-8H2,1-6H3,(H2,26,29,31)(H,25,27,28,30) |
| InChIKey | HHCBMISMPSAZBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. necroptosis inhibitor Any substance that inhibits the process of necroptosis (programmed form of necrosis) in organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY3009120 (CHEBI:167662) has role antineoplastic agent (CHEBI:35610) |
| LY3009120 (CHEBI:167662) has role apoptosis inducer (CHEBI:68495) |
| LY3009120 (CHEBI:167662) has role autophagy inducer (CHEBI:138880) |
| LY3009120 (CHEBI:167662) has role B-Raf inhibitor (CHEBI:75047) |
| LY3009120 (CHEBI:167662) has role necroptosis inhibitor (CHEBI:167704) |
| LY3009120 (CHEBI:167662) is a aminotoluene (CHEBI:22531) |
| LY3009120 (CHEBI:167662) is a aromatic amine (CHEBI:33860) |
| LY3009120 (CHEBI:167662) is a biaryl (CHEBI:64459) |
| LY3009120 (CHEBI:167662) is a monofluorobenzenes (CHEBI:83575) |
| LY3009120 (CHEBI:167662) is a phenylureas (CHEBI:134043) |
| LY3009120 (CHEBI:167662) is a pyridopyrimidine (CHEBI:38932) |
| LY3009120 (CHEBI:167662) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 1-(3,3-dimethylbutyl)-3-{2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl}urea |
| Synonyms | Source |
|---|---|
| DP 4978 | ChemIDplus |
| DP-4978 | ChemIDplus |
| DP4978 | ChEBI |
| N-(3,3-dimethylbutyl)-N'-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]urea | ChEBI |
| LY 3009120 | ChemIDplus |
| LY-3009120 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4Z5 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1454682-72-4 | ChemIDplus |
| Citations |
|---|