EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H25FN6O3 |
| Net Charge | 0 |
| Average Mass | 512.545 |
| Monoisotopic Mass | 512.19722 |
| SMILES | O=C1NC(=O)C(c2cnc3ccccn23)=C1c1cn2c3c(cc(F)cc13)CN(C(=O)N1CCCCC1)CC2 |
| InChI | InChI=1S/C28H25FN6O3/c29-18-12-17-15-34(28(38)32-7-3-1-4-8-32)11-10-33-16-20(19(13-18)25(17)33)23-24(27(37)31-26(23)36)21-14-30-22-6-2-5-9-35(21)22/h2,5-6,9,12-14,16H,1,3-4,7-8,10-11,15H2,(H,31,36,37) |
| InChIKey | HRJWTAWVFDCTGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | Wnt signalling activator A substance that activates any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY-2090314 (CHEBI:167661) has role antineoplastic agent (CHEBI:35610) |
| LY-2090314 (CHEBI:167661) has role apoptosis inducer (CHEBI:68495) |
| LY-2090314 (CHEBI:167661) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| LY-2090314 (CHEBI:167661) has role Wnt signalling activator (CHEBI:131492) |
| LY-2090314 (CHEBI:167661) is a diazepinoindole (CHEBI:134605) |
| LY-2090314 (CHEBI:167661) is a imidazopyridine (CHEBI:46908) |
| LY-2090314 (CHEBI:167661) is a maleimides (CHEBI:55417) |
| LY-2090314 (CHEBI:167661) is a monofluorobenzenes (CHEBI:83575) |
| LY-2090314 (CHEBI:167661) is a piperidinecarboxamide (CHEBI:48592) |
| LY-2090314 (CHEBI:167661) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 3-[9-fluoro-2-(piperidin-1-ylcarbonyl)-1,2,3,4-tetrahydro[1,4]diazepino[6,7,1-hi]indol-7-yl]-4-(imidazo[1,2-a]pyridin-3-yl)-1H-pyrrole-2,5-dione |
| Synonyms | Source |
|---|---|
| 3-[9-fluoro-1,2,3,4-tetrahydro-2-(1-piperidinylcarbonyl)pyrrolo[3,2,1-jk][1,4]benzodiazepin-7-yl]-4-imidazo[1,2-a]pyridin-3-yl-1H-pyrrole-2,5-dione | ChEBI |
| LY 2090314 | ChemIDplus |
| LY2090314 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:603288-22-8 | ChemIDplus |
| Citations |
|---|