EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O4 |
| Net Charge | 0 |
| Average Mass | 156.137 |
| Monoisotopic Mass | 156.04226 |
| SMILES | CC1(CC(=O)O)C=CC(=O)O1 |
| InChI | InChI=1S/C7H8O4/c1-7(4-5(8)9)3-2-6(10)11-7/h2-3H,4H2,1H3,(H,8,9) |
| InChIKey | FIKLRROSHXQNFN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxymethyl-4-methylbut-2-en-1,4-olide (CHEBI:16766) is a 5-oxo-2-furylacetic acid (CHEBI:23730) |
| 4-carboxymethyl-4-methylbut-2-en-1,4-olide (CHEBI:16766) is conjugate acid of 4-carboxylatomethyl-4-methylbut-2-en-1,4-olide(1−) (CHEBI:57888) |
| Incoming Relation(s) |
| 4-carboxylatomethyl-4-methylbut-2-en-1,4-olide(1−) (CHEBI:57888) is conjugate base of 4-carboxymethyl-4-methylbut-2-en-1,4-olide (CHEBI:16766) |
| IUPAC Name |
|---|
| (2-methyl-5-oxo-2,5-dihydrofuran-2-yl)acetic acid |
| Synonyms | Source |
|---|---|
| 4-Carboxymethyl-4-methylbut-2-en-1,4-olide | KEGG COMPOUND |
| 4-Carboxymethyl-4-methylbut-2-en-1,4-olide | KEGG COMPOUND |
| 4-methylmuconolactone | ChEBI |
| 4-methylmuconolactone | ChEBI |
| 4-Methylmuconolactone | KEGG COMPOUND |
| 5-carboxymethyl-5-methylfuran-2(5H)-one | ChEBI |