EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14FIN4O3 |
| Net Charge | 0 |
| Average Mass | 456.215 |
| Monoisotopic Mass | 456.00947 |
| SMILES | O=C(NOCCO)c1ccc2cncn2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H14FIN4O3/c17-13-7-10(18)1-4-14(13)20-15-12(16(24)21-25-6-5-23)3-2-11-8-19-9-22(11)15/h1-4,7-9,20,23H,5-6H2,(H,21,24) |
| InChIKey | RFWVETIZUQEJEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor An EC 2.7.12.* [dual-specificity kinases (those acting on Ser/Thr and Tyr residues)] inhibitor that inhibits the action of mitogen-activated protein kinase kinase (EC 2.7.12.2). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDC-0623 (CHEBI:167659) has role antineoplastic agent (CHEBI:35610) |
| GDC-0623 (CHEBI:167659) has role apoptosis inducer (CHEBI:68495) |
| GDC-0623 (CHEBI:167659) has role EC 2.7.12.2 (mitogen-activated protein kinase kinase) inhibitor (CHEBI:88286) |
| GDC-0623 (CHEBI:167659) is a hydroxamic acid ester (CHEBI:75606) |
| GDC-0623 (CHEBI:167659) is a imidazopyridine (CHEBI:46908) |
| GDC-0623 (CHEBI:167659) is a monofluorobenzenes (CHEBI:83575) |
| GDC-0623 (CHEBI:167659) is a organoiodine compound (CHEBI:37142) |
| GDC-0623 (CHEBI:167659) is a primary alcohol (CHEBI:15734) |
| GDC-0623 (CHEBI:167659) is a secondary amino compound (CHEBI:50995) |
| GDC-0623 (CHEBI:167659) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 5-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)imidazo[1,5-a]pyridine-6-carboxamide |
| Synonyms | Source |
|---|---|
| GDC0623 | ChEBI |
| GDC 0623 | ChemIDplus |
| RG 7421 | ChemIDplus |
| 5-[(2-fluoro-4-iodophenyl)amino]-N-(2-hydroxyethoxy)imidazo[1,5-a]pyridine-6-carboxamide | ChEBI |
| G-868 | ChEBI |
| G 868 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1168091-68-6 | ChemIDplus |
| Citations |
|---|