EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17Cl2N9O2 |
| Net Charge | 0 |
| Average Mass | 486.323 |
| Monoisotopic Mass | 485.08823 |
| SMILES | Nc1nc(NCCNc2ncc(-n3ccnc3)c(-c3ccc(Cl)cc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17Cl2N9O2/c21-12-1-2-13(14(22)9-12)18-16(30-8-7-24-11-30)10-27-20(29-18)26-6-5-25-17-4-3-15(31(32)33)19(23)28-17/h1-4,7-11H,5-6H2,(H3,23,25,28)(H,26,27,29) |
| InChIKey | MDZCSIDIPDZWKL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | tau aggregation inhibitor A chemical that inhibits the aggregation of the tau protein (HGNC:MAPT) and its distinct morphological forms (e.g. paired helical fragments (PHFs), straight filaments (SFs), oligomers, or larger aggregates). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. Wnt signalling activator A substance that activates any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CHIR-98014 (CHEBI:167657) has role antineoplastic agent (CHEBI:35610) |
| CHIR-98014 (CHEBI:167657) has role apoptosis inducer (CHEBI:68495) |
| CHIR-98014 (CHEBI:167657) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| CHIR-98014 (CHEBI:167657) has role hypoglycemic agent (CHEBI:35526) |
| CHIR-98014 (CHEBI:167657) has role tau aggregation inhibitor (CHEBI:142738) |
| CHIR-98014 (CHEBI:167657) has role Wnt signalling activator (CHEBI:131492) |
| CHIR-98014 (CHEBI:167657) is a C-nitro compound (CHEBI:35716) |
| CHIR-98014 (CHEBI:167657) is a aminopyrimidine (CHEBI:38338) |
| CHIR-98014 (CHEBI:167657) is a diaminopyridine (CHEBI:51598) |
| CHIR-98014 (CHEBI:167657) is a dichlorobenzene (CHEBI:23697) |
| CHIR-98014 (CHEBI:167657) is a imidazoles (CHEBI:24780) |
| CHIR-98014 (CHEBI:167657) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N6-(2-{[4-(2,4-dichlorophenyl)-5-(1H-imidazol-1-yl)pyrimidin-2-yl]amino}ethyl)-3-nitropyridine-2,6-diamine |
| Synonyms | Source |
|---|---|
| 6-N-[2-[[4-(2,4-dichlorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine | ChEBI |
| CHIR98014 | ChEBI |
| CHIR 98014 | ChEBI |
| N-6-[2-[[4-(2,4-dichlorophenyl)-5-(1H-imidazol-1-yl)-2-pyrimidinyl]amino]ethyl]-3-nitro-2,6-pyridinediamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 27445282 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:252935-94-7 | ChEBI |
| Citations |
|---|