EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17Cl2N9O2 |
| Net Charge | 0 |
| Average Mass | 486.323 |
| Monoisotopic Mass | 485.08823 |
| SMILES | Nc1nc(NCCNc2ncc(-n3ccnc3)c(-c3ccc(Cl)cc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17Cl2N9O2/c21-12-1-2-13(14(22)9-12)18-16(30-8-7-24-11-30)10-27-20(29-18)26-6-5-25-17-4-3-15(31(32)33)19(23)28-17/h1-4,7-11H,5-6H2,(H3,23,25,28)(H,26,27,29) |
| InChIKey | MDZCSIDIPDZWKL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. Wnt signalling activator A substance that activates any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. tau aggregation inhibitor A chemical that inhibits the aggregation of the tau protein (HGNC:MAPT) and its distinct morphological forms (e.g. paired helical fragments (PHFs), straight filaments (SFs), oligomers, or larger aggregates). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CHIR-98014 (CHEBI:167657) has role antineoplastic agent (CHEBI:35610) |
| CHIR-98014 (CHEBI:167657) has role apoptosis inducer (CHEBI:68495) |
| CHIR-98014 (CHEBI:167657) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| CHIR-98014 (CHEBI:167657) has role hypoglycemic agent (CHEBI:35526) |
| CHIR-98014 (CHEBI:167657) has role tau aggregation inhibitor (CHEBI:142738) |
| CHIR-98014 (CHEBI:167657) has role Wnt signalling activator (CHEBI:131492) |
| CHIR-98014 (CHEBI:167657) is a C-nitro compound (CHEBI:35716) |
| CHIR-98014 (CHEBI:167657) is a aminopyrimidine (CHEBI:38338) |
| CHIR-98014 (CHEBI:167657) is a diaminopyridine (CHEBI:51598) |
| CHIR-98014 (CHEBI:167657) is a dichlorobenzene (CHEBI:23697) |
| CHIR-98014 (CHEBI:167657) is a imidazoles (CHEBI:24780) |
| CHIR-98014 (CHEBI:167657) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N6-(2-{[4-(2,4-dichlorophenyl)-5-(1H-imidazol-1-yl)pyrimidin-2-yl]amino}ethyl)-3-nitropyridine-2,6-diamine |
| Synonyms | Source |
|---|---|
| 6-N-[2-[[4-(2,4-dichlorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]amino]ethyl]-3-nitropyridine-2,6-diamine | ChEBI |
| CHIR 98014 | ChEBI |
| CHIR98014 | ChEBI |
| N-6-[2-[[4-(2,4-dichlorophenyl)-5-(1H-imidazol-1-yl)-2-pyrimidinyl]amino]ethyl]-3-nitro-2,6-pyridinediamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 27445282 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:252935-94-7 | ChEBI |
| Citations |
|---|