EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25ClN6O |
| Net Charge | 0 |
| Average Mass | 448.958 |
| Monoisotopic Mass | 448.17784 |
| SMILES | COc1cc(N2CCC(N)CC2)ccc1Nc1ncc(Cl)c(-c2cnc3ccccc23)n1 |
| InChI | InChI=1S/C24H25ClN6O/c1-32-22-12-16(31-10-8-15(26)9-11-31)6-7-21(22)29-24-28-14-19(25)23(30-24)18-13-27-20-5-3-2-4-17(18)20/h2-7,12-15,27H,8-11,26H2,1H3,(H,28,29,30) |
| InChIKey | GCYIGMXOIWJGBU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD3463 (CHEBI:167653) has role antineoplastic agent (CHEBI:35610) |
| AZD3463 (CHEBI:167653) has role apoptosis inducer (CHEBI:68495) |
| AZD3463 (CHEBI:167653) has role autophagy inducer (CHEBI:138880) |
| AZD3463 (CHEBI:167653) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| AZD3463 (CHEBI:167653) is a aminopiperidine (CHEBI:48588) |
| AZD3463 (CHEBI:167653) is a aminopyrimidine (CHEBI:38338) |
| AZD3463 (CHEBI:167653) is a indoles (CHEBI:24828) |
| AZD3463 (CHEBI:167653) is a monomethoxybenzene (CHEBI:25235) |
| AZD3463 (CHEBI:167653) is a organochlorine compound (CHEBI:36683) |
| AZD3463 (CHEBI:167653) is a secondary amino compound (CHEBI:50995) |
| AZD3463 (CHEBI:167653) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[4-(4-aminopiperidin-1-yl)-2-methoxyphenyl]-5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine |
| Synonyms | Source |
|---|---|
| AZD 3463 | ChEBI |
| AZD-3463 | ChEBI |
| N-[4-(4-amino-1-piperidinyl)-2-methoxyphenyl]-5-chloro-4-(1H-indol-3-yl)-2-pyrimidinamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 29315067 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1356962-20-3 | ChEBI |
| Citations |
|---|