EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N7O3S |
| Net Charge | 0 |
| Average Mass | 453.528 |
| Monoisotopic Mass | 453.15831 |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(-c3cnc(N)c(C(=O)Nc4cccnc4)n3)cc2)CC1 |
| InChI | InChI=1S/C21H23N7O3S/c1-27-9-11-28(12-10-27)32(30,31)17-6-4-15(5-7-17)18-14-24-20(22)19(26-18)21(29)25-16-3-2-8-23-13-16/h2-8,13-14H,9-12H2,1H3,(H2,22,24)(H,25,29) |
| InChIKey | FHCSBLWRGCOVPT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Wnt signalling activator A substance that activates any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD2858 (CHEBI:167652) has role antineoplastic agent (CHEBI:35610) |
| AZD2858 (CHEBI:167652) has role bone density conservation agent (CHEBI:50646) |
| AZD2858 (CHEBI:167652) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| AZD2858 (CHEBI:167652) has role Wnt signalling activator (CHEBI:131492) |
| AZD2858 (CHEBI:167652) is a N-methylpiperazine (CHEBI:46920) |
| AZD2858 (CHEBI:167652) is a aromatic amine (CHEBI:33860) |
| AZD2858 (CHEBI:167652) is a pyrazines (CHEBI:38314) |
| AZD2858 (CHEBI:167652) is a pyridines (CHEBI:26421) |
| AZD2858 (CHEBI:167652) is a secondary carboxamide (CHEBI:140325) |
| AZD2858 (CHEBI:167652) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 3-amino-6-{4-[(4-methylpiperazin-1-yl)sulfonyl]phenyl}-N-(pyridin-3-yl)pyrazine-2-carboxamide |
| Synonyms | Source |
|---|---|
| AZD 2858 | ChEBI |
| AZD-2858 | ChEBI |
| 3-amino-6-[4-[(4-methyl-1-piperazinyl)sulfonyl]phenyl]-N-3-pyridinyl-2-pyrazinecarboxamide | ChEBI |
| Citations |
|---|