EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O2 |
| Net Charge | 0 |
| Average Mass | 334.379 |
| Monoisotopic Mass | 334.14298 |
| SMILES | N#Cc1ccc2nc(O)c(-c3ccc(CN4CCOCC4)cn3)c2c1 |
| InChI | InChI=1S/C19H18N4O2/c20-10-13-1-3-16-15(9-13)18(19(24)22-16)17-4-2-14(11-21-17)12-23-5-7-25-8-6-23/h1-4,9,11,22,24H,5-8,12H2 |
| InChIKey | BLTVBQXJFVRPFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. tau aggregation inhibitor A chemical that inhibits the aggregation of the tau protein (HGNC:MAPT) and its distinct morphological forms (e.g. paired helical fragments (PHFs), straight filaments (SFs), oligomers, or larger aggregates). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD1080 (CHEBI:167651) has role antineoplastic agent (CHEBI:35610) |
| AZD1080 (CHEBI:167651) has role apoptosis inducer (CHEBI:68495) |
| AZD1080 (CHEBI:167651) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| AZD1080 (CHEBI:167651) has role tau aggregation inhibitor (CHEBI:142738) |
| AZD1080 (CHEBI:167651) is a hydroxyindoles (CHEBI:84729) |
| AZD1080 (CHEBI:167651) is a morpholines (CHEBI:38785) |
| AZD1080 (CHEBI:167651) is a nitrile (CHEBI:18379) |
| AZD1080 (CHEBI:167651) is a pyridines (CHEBI:26421) |
| AZD1080 (CHEBI:167651) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-hydroxy-3-[5-(morpholin-4-ylmethyl)pyridin-2-yl]-1H-indole-5-carbonitrile |
| Synonyms | Source |
|---|---|
| 2-hydroxy-3-[5-(4-morpholinylmethyl)-2-pyridinyl]-1H-indole-5-carbonitrile | ChEBI |
| AZ-11548415 | ChemIDplus |
| AZD 1080 | ChEBI |
| AZD-1080 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 24808514 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:612487-72-6 | ChemIDplus |
| Citations |
|---|