EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O2 |
| Net Charge | 0 |
| Average Mass | 334.379 |
| Monoisotopic Mass | 334.14298 |
| SMILES | N#Cc1ccc2nc(O)c(-c3ccc(CN4CCOCC4)cn3)c2c1 |
| InChI | InChI=1S/C19H18N4O2/c20-10-13-1-3-16-15(9-13)18(19(24)22-16)17-4-2-14(11-21-17)12-23-5-7-25-8-6-23/h1-4,9,11,22,24H,5-8,12H2 |
| InChIKey | BLTVBQXJFVRPFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.11.26 (tau-protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of tau-protein kinase inhibitor (EC 2.7.11.26). tau aggregation inhibitor A chemical that inhibits the aggregation of the tau protein (HGNC:MAPT) and its distinct morphological forms (e.g. paired helical fragments (PHFs), straight filaments (SFs), oligomers, or larger aggregates). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD1080 (CHEBI:167651) has role antineoplastic agent (CHEBI:35610) |
| AZD1080 (CHEBI:167651) has role apoptosis inducer (CHEBI:68495) |
| AZD1080 (CHEBI:167651) has role EC 2.7.11.26 (tau-protein kinase) inhibitor (CHEBI:91092) |
| AZD1080 (CHEBI:167651) has role tau aggregation inhibitor (CHEBI:142738) |
| AZD1080 (CHEBI:167651) is a hydroxyindoles (CHEBI:84729) |
| AZD1080 (CHEBI:167651) is a morpholines (CHEBI:38785) |
| AZD1080 (CHEBI:167651) is a nitrile (CHEBI:18379) |
| AZD1080 (CHEBI:167651) is a pyridines (CHEBI:26421) |
| AZD1080 (CHEBI:167651) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-hydroxy-3-[5-(morpholin-4-ylmethyl)pyridin-2-yl]-1H-indole-5-carbonitrile |
| Synonyms | Source |
|---|---|
| AZD 1080 | ChEBI |
| AZD-1080 | ChemIDplus |
| 2-hydroxy-3-[5-(4-morpholinylmethyl)-2-pyridinyl]-1H-indole-5-carbonitrile | ChEBI |
| AZ-11548415 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 24808514 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:612487-72-6 | ChemIDplus |
| Citations |
|---|