EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCO |
| InChI | InChI=1S/C20H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)23-19-18-21/h21H,2-19H2,1H3 |
| InChIKey | RFVNOJDQRGSOEL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | emulsifier The chemical role played by a substance that stabilizes an emulsion by increasing its kinetic stability. nonionic surfactant A surfactant with an uncharged hydrophilic headgroup. |
| Application: | plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyethyl octadecanoate (CHEBI:167626) has functional parent ethylene glycol (CHEBI:30742) |
| 2-hydroxyethyl octadecanoate (CHEBI:167626) has role emulsifier (CHEBI:63046) |
| 2-hydroxyethyl octadecanoate (CHEBI:167626) has role nonionic surfactant (CHEBI:38828) |
| 2-hydroxyethyl octadecanoate (CHEBI:167626) has role plasticiser (CHEBI:79056) |
| 2-hydroxyethyl octadecanoate (CHEBI:167626) is a long-chain primary fatty alcohol (CHEBI:77396) |
| 2-hydroxyethyl octadecanoate (CHEBI:167626) is a octadecanoate ester (CHEBI:75925) |
| IUPAC Name |
|---|
| 2-hydroxyethyl octadecanoate |
| Synonyms | Source |
|---|---|
| 2-hydroxyethyl stearate | ChEBI |
| ethylene glycol monostearate | ChemIDplus |
| ethylene glycol stearate | ChemIDplus |
| glycol monostearate | ChemIDplus |
| glycol stearate | ChemIDplus |
| octadecanoic acid 2-hydroxyethyl ester | ChemIDplus |
| Brand Names | Source |
|---|---|
| Clindrol SEG | ChemIDplus |
| Emerest 2350 | ChemIDplus |
| Empilan 2848 | ChemIDplus |
| Ivorit | ChemIDplus |
| Lipo EGMS | ChemIDplus |
| Monthybase | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 23148 | ChemSpider |
| Glycol_stearate | Wikipedia |
| Citations |
|---|