EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11O2 |
| Net Charge | -1 |
| Average Mass | 115.152 |
| Monoisotopic Mass | 115.07645 |
| SMILES | CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C6H12O2/c1-3-4-5(2)6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/p-1 |
| InChIKey | OVBFMEVBMNZIBR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylvalerate (CHEBI:167611) is a branched-chain saturated fatty acid anion (CHEBI:58956) |
| 2-methylvalerate (CHEBI:167611) is a methyl-branched fatty acid anion (CHEBI:67013) |
| 2-methylvalerate (CHEBI:167611) is a monocarboxylic acid anion (CHEBI:35757) |
| 2-methylvalerate (CHEBI:167611) is a short-chain fatty acid anion (CHEBI:58951) |
| 2-methylvalerate (CHEBI:167611) is conjugate base of 2-methylvaleric acid (CHEBI:167644) |
| Incoming Relation(s) |
| 2-methylvaleric acid (CHEBI:167644) is conjugate acid of 2-methylvalerate (CHEBI:167611) |
| IUPAC Name |
|---|
| 2-methylpentanoate |
| Synonyms | Source |
|---|---|
| 2-methylvalerate | SUBMITTER |
| α-methylvalerate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methylpentanoate | UniProt |
| Citations |
|---|