EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16 |
| Net Charge | 0 |
| Average Mass | 112.216 |
| Monoisotopic Mass | 112.12520 |
| SMILES | C[C@H]1CC[C@H](C)CC1 |
| InChI | InChI=1S/C8H16/c1-7-3-5-8(2)6-4-7/h7-8H,3-6H2,1-2H3/t7-,8- |
| InChIKey | QRMPKOFEUHIBNM-ZKCHVHJHSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-1,4-dimethylcyclohexane (CHEBI:167603) is a 1,4-dimethylcyclohexane (CHEBI:165732) |
| IUPAC Name |
|---|
| trans-1,4-dimethylcyclohexane |
| Synonyms | Source |
|---|---|
| 1,4(trans)-dimethylcyclohexane | NIST Chemistry WebBook |
| (1r,4r)-1,4-dimethylcyclohexane | IUPAC |
| 1,trans-4-dimethylcyclohexane | NIST Chemistry WebBook |
| trans-p-hexahydroxylene | ChEBI |
| trans-hexahydro-p-xylene | ChEBI |
| Citations |
|---|