EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16 |
| Net Charge | 0 |
| Average Mass | 112.216 |
| Monoisotopic Mass | 112.12520 |
| SMILES | C[C@H]1CC[C@@H](C)CC1 |
| InChI | InChI=1S/C8H16/c1-7-3-5-8(2)6-4-7/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | QRMPKOFEUHIBNM-OCAPTIKFSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-1,4-dimethylcyclohexane (CHEBI:167602) is a 1,4-dimethylcyclohexane (CHEBI:165732) |
| IUPAC Name |
|---|
| cis-1,4-dimethylcyclohexane |
| Synonyms | Source |
|---|---|
| 1,4(cis)-dimethylcyclohexane | NIST Chemistry WebBook |
| 1,cis-4-dimethylcyclohexane | NIST Chemistry WebBook |
| (1s,4s)-1,4-dimethylcyclohexane | IUPAC |
| cis-p-hexahydroxylene | ChEBI |
| cis-hexahydro-p-xylene | ChEBI |
| Citations |
|---|