EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N6O |
| Net Charge | 0 |
| Average Mass | 310.361 |
| Monoisotopic Mass | 310.15421 |
| SMILES | C[C@H]1CN(C(=O)CC#N)[C@]12CCN(c1ncnc3nccc13)C2 |
| InChI | InChI=1S/C16H18N6O/c1-11-8-22(13(23)2-5-17)16(11)4-7-21(9-16)15-12-3-6-18-14(12)19-10-20-15/h3,6,10-11H,2,4,7-9H2,1H3,(H,18,19,20)/t11-,16-/m0/s1 |
| InChIKey | LOWWYYZBZNSPDT-ZBEGNZNMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Applications: | antiseborrheic A drug or agent applied to the skin to control seborrhea or seborrheic dermatitis. anti-inflammatory drug A substance that reduces or suppresses inflammation. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delgocitinib (CHEBI:167600) has role anti-inflammatory drug (CHEBI:35472) |
| delgocitinib (CHEBI:167600) has role antipsoriatic (CHEBI:50748) |
| delgocitinib (CHEBI:167600) has role antiseborrheic (CHEBI:59010) |
| delgocitinib (CHEBI:167600) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| delgocitinib (CHEBI:167600) is a N-acylazetidine (CHEBI:46959) |
| delgocitinib (CHEBI:167600) is a azaspiro compound (CHEBI:35624) |
| delgocitinib (CHEBI:167600) is a nitrile (CHEBI:18379) |
| delgocitinib (CHEBI:167600) is a pyrrolopyrimidine (CHEBI:38670) |
| delgocitinib (CHEBI:167600) is a tertiary amino compound (CHEBI:50996) |
| delgocitinib (CHEBI:167600) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 3-[(3S,4R)-3-methyl-6-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,6-diazaspiro[3.4]octan-1-yl]-3-oxopropanenitrile |
| INNs | Source |
|---|---|
| delgocitinib | WHO MedNet |
| delgocitinib | WHO MedNet |
| delgocitinib | WHO MedNet |
| delgocitinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| JTE-052 | ChemIDplus |
| JTE-052A | ChemIDplus |
| LEO 124249 | ChemIDplus |
| LEO-124249 | DrugBank |
| LEO 124249A | ChemIDplus |
| LEO-124249A | DrugBank |
| Brand Name | Source |
|---|---|
| Corectim | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 59718502 | ChemSpider |
| D11046 | KEGG DRUG |
| DB16133 | DrugBank |
| FHX | PDBeChem |
| US20140187534 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:1263774-59-9 | ChemIDplus |
| Citations |
|---|