EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O7 |
| Net Charge | 0 |
| Average Mass | 382.368 |
| Monoisotopic Mass | 382.10525 |
| SMILES | COc1ccc2c(c1OC)C(=O)c1ccc(/C=C(/C)CC(=O)O)c(O)c1C2=O |
| InChI | InChI=1S/C21H18O7/c1-10(9-15(22)23)8-11-4-5-12-16(18(11)24)19(25)13-6-7-14(27-2)21(28-3)17(13)20(12)26/h4-8,24H,9H2,1-3H3,(H,22,23)/b10-8- |
| InChIKey | UBMNDGOTJSQUMP-NTMALXAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. SN-593 (ncbitaxon:659352) | - | PubMed (33590007 ) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kinanthraquinone B (CHEBI:167576) has role bacterial metabolite (CHEBI:76969) |
| kinanthraquinone B (CHEBI:167576) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| kinanthraquinone B (CHEBI:167576) is a monohydroxyanthraquinone (CHEBI:37483) |
| kinanthraquinone B (CHEBI:167576) is a olefinic compound (CHEBI:78840) |
| kinanthraquinone B (CHEBI:167576) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| kinanthraquinone (CHEBI:167575) has functional parent kinanthraquinone B (CHEBI:167576) |
| IUPAC Name |
|---|
| (3Z)-4-(1-hydroxy-5,6-dimethoxy-9,10-dioxo-9,10-dihydroanthracen-2-yl)-3-methylbut-3-enoic acid |
| Citations |
|---|