EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O3 |
| Net Charge | 0 |
| Average Mass | 216.321 |
| Monoisotopic Mass | 216.17254 |
| SMILES | CCCC(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C12H24O3/c1-2-8-11(13)9-6-4-3-5-7-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) |
| InChIKey | XKNUGGWMUJBFJT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Blepharis scindica (ncbitaxon:1569727) | seed (BTO:0001226) | DOI (10.1016/0031-9422(83)83032-5) | |
| Cedrus deodara (ncbitaxon:3322) | - | PubMed (20575413) | Found in pine needles. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-hydroxylauric acid (CHEBI:167568) has functional parent dodecanoic acid (CHEBI:30805) |
| 9-hydroxylauric acid (CHEBI:167568) has role plant metabolite (CHEBI:76924) |
| 9-hydroxylauric acid (CHEBI:167568) is a hydroxy fatty acid (CHEBI:24654) |
| 9-hydroxylauric acid (CHEBI:167568) is a medium-chain fatty acid (CHEBI:59554) |
| 9-hydroxylauric acid (CHEBI:167568) is conjugate acid of 9-hydroxylaurate (CHEBI:167543) |
| Incoming Relation(s) |
| 9-hydroxylaurate (CHEBI:167543) is conjugate base of 9-hydroxylauric acid (CHEBI:167568) |
| IUPAC Name |
|---|
| 9-hydroxydodecanoic acid |
| Synonyms | Source |
|---|---|
| 9-hydroxy-dodecanoic acid | LIPID MAPS |
| (ω-3)-hydroxylauric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050167 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:68490-89-1 | ChEBI |
| Citations |
|---|