EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21N3O3S |
| Net Charge | 0 |
| Average Mass | 407.495 |
| Monoisotopic Mass | 407.13036 |
| SMILES | CSCc1nc2c(nc1=O)[C@@H](C)C1(C(=O)N(C)c3ccccc31)C1=C2C(=O)CC1 |
| InChI | InChI=1S/C22H21N3O3S/c1-11-18-19(23-14(10-29-3)20(27)24-18)17-13(8-9-16(17)26)22(11)12-6-4-5-7-15(12)25(2)21(22)28/h4-7,11H,8-10H2,1-3H3,(H,24,27)/t11-,22?/m1/s1 |
| InChIKey | NRFFIDZDMKFXMS-FAYKFVSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. B9173 (ncbitaxon:1462558) | - | PubMed (28572321) | GenBank: KC836748.1 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maremycin G (CHEBI:167566) has role bacterial metabolite (CHEBI:76969) |
| maremycin G (CHEBI:167566) is a antibiotic antifungal agent (CHEBI:86478) |
| maremycin G (CHEBI:167566) is a cyclic ketone (CHEBI:3992) |
| maremycin G (CHEBI:167566) is a enone (CHEBI:51689) |
| maremycin G (CHEBI:167566) is a indole alkaloid (CHEBI:38958) |
| maremycin G (CHEBI:167566) is a indolones (CHEBI:24829) |
| maremycin G (CHEBI:167566) is a methyl sulfide (CHEBI:86315) |
| maremycin G (CHEBI:167566) is a organic heteropentacyclic compound (CHEBI:38164) |
| maremycin G (CHEBI:167566) is a piperazinone (CHEBI:46846) |
| maremycin G (CHEBI:167566) is a spiro compound (CHEBI:33599) |
| IUPAC Name |
|---|
| (5S)-1',5-dimethyl-2-[(methylsulfanyl)methyl]-7,8-dihydrospiro[cyclopenta[f]quinoxaline-6,3'-indole]-2',3,9(1'H,4H,5H)-trione |
| Synonyms | Source |
|---|---|
| (5S)-1',5-dimethyl-2-[(methylsulfanyl)methyl]-4,5,7,8-tetrahydrospiro[cyclopenta[f]quinoxaline-6,3'-indole]-2',3,9-trione | ChEBI |
| (5S)-1',5-dimethyl-2-[(methylsulfanyl)methyl]-1',2',3,4,5,7,8,9-octahydrospiro[cyclopenta[f]quinoxaline-6,3'- indole]-2',3,9-trione | IUPAC |
| Citations |
|---|