EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O4 |
| Net Charge | 0 |
| Average Mass | 384.516 |
| Monoisotopic Mass | 384.23006 |
| SMILES | C/C=C(/CCCCCCC/C=C\C=C\C=C/Cc1cc(O)cc(O)c1)C(=O)O |
| InChI | InChI=1S/C24H32O4/c1-2-21(24(27)28)16-14-12-10-8-6-4-3-5-7-9-11-13-15-20-17-22(25)19-23(26)18-20/h2-3,5,7,9,11,13,17-19,25-26H,4,6,8,10,12,14-16H2,1H3,(H,27,28)/b5-3-,9-7+,13-11-,21-2- |
| InChIKey | KNXPXXWZSYPYFN-VQJZLJOXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium soppi (ncbitaxon:69789) | - | PubMed (31086874) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soppiline C (CHEBI:167563) has role Penicillium metabolite (CHEBI:76964) |
| soppiline C (CHEBI:167563) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| soppiline C (CHEBI:167563) is a olefinic compound (CHEBI:78840) |
| soppiline C (CHEBI:167563) is a polyketide (CHEBI:26188) |
| soppiline C (CHEBI:167563) is a resorcinols (CHEBI:33572) |
| soppiline C (CHEBI:167563) is conjugate acid of soppiline C(1−) (CHEBI:167551) |
| Incoming Relation(s) |
| soppiline C(1−) (CHEBI:167551) is conjugate base of soppiline C (CHEBI:167563) |
| IUPAC Name |
|---|
| (2Z,10Z,12E,14Z)-16-(3,5-dihydroxyphenyl)-2-ethylidenehexadeca-10,12,14-trienoic acid |
| Citations |
|---|