EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | CCCCCc1cc2c(c(O)c1C(=O)O)C=CC(C)(CCC=C(C)C)O2 |
| InChI | InChI=1S/C22H30O4/c1-5-6-7-10-16-14-18-17(20(23)19(16)21(24)25)11-13-22(4,26-18)12-8-9-15(2)3/h9,11,13-14,23H,5-8,10,12H2,1-4H3,(H,24,25) |
| InChIKey | HRHJHXJQMNWQTF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | - | DOI (10.1038/s41598-020-60172-6) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cannabichromenic acid (CHEBI:167557) has role antibacterial agent (CHEBI:33282) |
| cannabichromenic acid (CHEBI:167557) has role plant metabolite (CHEBI:76924) |
| cannabichromenic acid (CHEBI:167557) is a chromenol (CHEBI:39436) |
| cannabichromenic acid (CHEBI:167557) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| cannabichromenic acid (CHEBI:167557) is a olefinic compound (CHEBI:78840) |
| cannabichromenic acid (CHEBI:167557) is a phytocannabinoid (CHEBI:67196) |
| cannabichromenic acid (CHEBI:167557) is conjugate acid of cannabichromenate (CHEBI:167554) |
| Incoming Relation(s) |
| cannabichromenate (CHEBI:167554) is conjugate base of cannabichromenic acid (CHEBI:167557) |
| IUPAC Name |
|---|
| 5-hydroxy-2-methyl-2-(4-methylpent-3-en-1-yl)-7-pentyl-2H-chromene-6-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-hydroxy-2-methyl-2-(4-methylpent-3-en-1-yl)-7-pentyl-2H-1-benzopyran-6-carboxylic acid | IUPAC |
| 5-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-7-pentylchromene-6-carboxylic acid | ChEBI |
| (+)-cannabichromenic acid | ChemIDplus |
| CBCA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2341420 | ChemSpider |
| C00053033 | KNApSAcK |
| GB2459125 | Patent |
| WO2009125198 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:20408-52-0 | ChemIDplus |
| Citations |
|---|